C17H21N5O3 — CID 71975456
1-(1,3-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-3-(4-nitropyrazol-1-yl)propan-1-one (PubChem CID 71975456) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-(1,3-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-3-(4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-(1,3-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-3-(4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 71975456 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-(1,3-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-3-(4-nitropyrazol-1-yl)propan-1-one |
| SMILES | CC1CN(C)c2ccccc2CN1C(=O)CCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H21N5O3/c1-13-10-19(2)16-6-4-3-5-14(16)11-21(13)17(23)7-8-20-12-15(9-18-20)22(24)25/h3-6,9,12-13H,7-8,10-11H2,1-2H3 |
| InChIKey | NGZOMJPLAGQANE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|