C15H16N4O3S — CID 97053553
1-[(2S)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]-3-(4-nitropyrazol-1-yl)propan-1-one (PubChem CID 97053553) has the molecular formula C15H16N4O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]-3-(4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-[(2S)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]-3-(4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 97053553 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[(2S)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]-3-(4-nitropyrazol-1-yl)propan-1-one |
| SMILES | C[C@H]1CN(C(=O)CCn2cc([N+](=O)[O-])cn2)c2ccccc2S1 |
| InChI | InChI=1S/C15H16N4O3S/c1-11-9-18(13-4-2-3-5-14(13)23-11)15(20)6-7-17-10-12(8-16-17)19(21)22/h2-5,8,10-11H,6-7,9H2,1H3/t11-/m0/s1 |
| InChIKey | RTHPSMQFATYLJL-NSHDSACASA-N |
| XLogP | 2.71 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|