C14H22F2N4O2S — CID 71976462
1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-(3-ethylsulfinylcyclohexyl)urea (PubChem CID 71976462) has the molecular formula C14H22F2N4O2S and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-(3-ethylsulfinylcyclohexyl)urea.
| Compound Name | 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-(3-ethylsulfinylcyclohexyl)urea |
|---|---|
| PubChem CID | 71976462 |
| Molecular Formula | C14H22F2N4O2S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)pyrazol-3-yl]-3-(3-ethylsulfinylcyclohexyl)urea |
| SMILES | CCS(=O)C1CCCC(NC(=O)Nc2ccn(CC(F)F)n2)C1 |
| InChI | InChI=1S/C14H22F2N4O2S/c1-2-23(22)11-5-3-4-10(8-11)17-14(21)18-13-6-7-20(19-13)9-12(15)16/h6-7,10-12H,2-5,8-9H2,1H3,(H2,17,18,19,21) |
| InChIKey | USOLSTYBERENAU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |