C11H18N4O3S — CID 164633786
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-propan-2-ylpyrazol-3-yl)urea (PubChem CID 164633786) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-propan-2-ylpyrazol-3-yl)urea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-propan-2-ylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 164633786 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(1-propan-2-ylpyrazol-3-yl)urea |
| SMILES | CC(C)n1ccc(NC(=O)N[C@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C11H18N4O3S/c1-8(2)15-5-3-10(14-15)13-11(16)12-9-4-6-19(17,18)7-9/h3,5,8-9H,4,6-7H2,1-2H3,(H2,12,13,14,16)/t9-/m0/s1 |
| InChIKey | CEUGTCMHYCNOAA-VIFPVBQESA-N |
| XLogP | 0.77 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |