C14H27N5O3S — CID 56795482
1-(1-tert-butylpyrazol-3-yl)-3-[3-[ethyl(methylsulfonyl)amino]propyl]urea (PubChem CID 56795482) has the molecular formula C14H27N5O3S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-(1-tert-butylpyrazol-3-yl)-3-[3-[ethyl(methylsulfonyl)amino]propyl]urea.
| Compound Name | 1-(1-tert-butylpyrazol-3-yl)-3-[3-[ethyl(methylsulfonyl)amino]propyl]urea |
|---|---|
| PubChem CID | 56795482 |
| Molecular Formula | C14H27N5O3S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-(1-tert-butylpyrazol-3-yl)-3-[3-[ethyl(methylsulfonyl)amino]propyl]urea |
| SMILES | CCN(CCCNC(=O)Nc1ccn(C(C)(C)C)n1)S(C)(=O)=O |
| InChI | InChI=1S/C14H27N5O3S/c1-6-18(23(5,21)22)10-7-9-15-13(20)16-12-8-11-19(17-12)14(2,3)4/h8,11H,6-7,9-10H2,1-5H3,(H2,15,16,17,20) |
| InChIKey | YFTVIYBJPSLTCE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|