C19H29N3 — CID 71976779
N-cyclohex-2-en-1-yl-N-methyl-1-(2-pyridin-2-ylethyl)piperidin-4-amine (PubChem CID 71976779) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-N-methyl-1-(2-pyridin-2-ylethyl)piperidin-4-amine.
| Compound Name | N-cyclohex-2-en-1-yl-N-methyl-1-(2-pyridin-2-ylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 71976779 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | N-cyclohex-2-en-1-yl-N-methyl-1-(2-pyridin-2-ylethyl)piperidin-4-amine |
| SMILES | CN(C1C=CCCC1)C1CCN(CCc2ccccn2)CC1 |
| InChI | InChI=1S/C19H29N3/c1-21(18-8-3-2-4-9-18)19-11-15-22(16-12-19)14-10-17-7-5-6-13-20-17/h3,5-8,13,18-19H,2,4,9-12,14-16H2,1H3 |
| InChIKey | FZQXFSXIWOBPNL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|