C18H18ClN3O2 — CID 71976794
[4-[3-(4-chlorophenyl)prop-2-ynyl]piperazin-1-yl]-(3-methyl-1,2-oxazol-5-yl)methanone (PubChem CID 71976794) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is [4-[3-(4-chlorophenyl)prop-2-ynyl]piperazin-1-yl]-(3-methyl-1,2-oxazol-5-yl)methanone.
| Compound Name | [4-[3-(4-chlorophenyl)prop-2-ynyl]piperazin-1-yl]-(3-methyl-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 71976794 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [4-[3-(4-chlorophenyl)prop-2-ynyl]piperazin-1-yl]-(3-methyl-1,2-oxazol-5-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(CC#Cc3ccc(Cl)cc3)CC2)on1 |
| InChI | InChI=1S/C18H18ClN3O2/c1-14-13-17(24-20-14)18(23)22-11-9-21(10-12-22)8-2-3-15-4-6-16(19)7-5-15/h4-7,13H,8-12H2,1H3 |
| InChIKey | YNPBRXSCGUHELX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|