methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate

C11H13N3O3 — CID 71977052

IUPACmethyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate
SMILESCCc1oc(C(=O)OC)cc1Cn1cncn1
InChIInChI=1S/C11H13N3O3/c1-3-9-8(5-14-7-12-6-13-14)4-10(17-9)11(15)16-2/h4,6-7H,3,5H2,1-2H3
InChIKeyIETLFCURJGKSQQ-UHFFFAOYSA-N
MW235.24 g/mol
LogP1.27
Rot. Bonds4

About methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate

methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate (PubChem CID 71977052) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate
PubChem CID71977052
Molecular FormulaC11H13N3O3
Molecular Weight235.24 g/mol
Exact Mass235.10
IUPAC Namemethyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate
SMILESCCc1oc(C(=O)OC)cc1Cn1cncn1
InChIInChI=1S/C11H13N3O3/c1-3-9-8(5-14-7-12-6-13-14)4-10(17-9)11(15)16-2/h4,6-7H,3,5H2,1-2H3
InChIKeyIETLFCURJGKSQQ-UHFFFAOYSA-N
XLogP1.27
TPSA70.15 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.24
LogP ≤ 51.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate?
The IUPAC name of methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate (CID 71977052) is methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate.
What is the SMILES notation for methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate?
The canonical SMILES for methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate is CCc1oc(C(=O)OC)cc1Cn1cncn1.
What is the InChIKey of methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate?
The InChIKey is IETLFCURJGKSQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c1-3-9-8(5-14-7-12-6-13-14)4-10(17-9)11(15)16-2/h4,6-7H,3,5H2,1-2H3.
What are the key properties of methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate?
methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate has a molecular weight of 235.24 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethyl-4-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylate is sourced from PubChem (CID 71977052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).