C15H19ClN2O3 — CID 71977415
2-(3-chlorophenyl)-2-[[2-(oxolan-2-yl)acetyl]amino]propanamide (PubChem CID 71977415) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-[[2-(oxolan-2-yl)acetyl]amino]propanamide.
| Compound Name | 2-(3-chlorophenyl)-2-[[2-(oxolan-2-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 71977415 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-(3-chlorophenyl)-2-[[2-(oxolan-2-yl)acetyl]amino]propanamide |
| SMILES | CC(NC(=O)CC1CCCO1)(C(N)=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-15(14(17)20,10-4-2-5-11(16)8-10)18-13(19)9-12-6-3-7-21-12/h2,4-5,8,12H,3,6-7,9H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | CLOURIPATSSGDL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |