C17H24ClN3O2 — CID 71861458
2-(3-chlorophenyl)-2-[[2-(4-methylpiperidin-1-yl)-2-oxoethyl]amino]propanamide (PubChem CID 71861458) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-[[2-(4-methylpiperidin-1-yl)-2-oxoethyl]amino]propanamide.
| Compound Name | 2-(3-chlorophenyl)-2-[[2-(4-methylpiperidin-1-yl)-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 71861458 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-(3-chlorophenyl)-2-[[2-(4-methylpiperidin-1-yl)-2-oxoethyl]amino]propanamide |
| SMILES | CC1CCN(C(=O)CNC(C)(C(N)=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-12-6-8-21(9-7-12)15(22)11-20-17(2,16(19)23)13-4-3-5-14(18)10-13/h3-5,10,12,20H,6-9,11H2,1-2H3,(H2,19,23) |
| InChIKey | ADSXXRQKPWFNCA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |