C12H12Cl2N4OS — CID 97088815
(2S)-2-(3-chlorophenyl)-2-[(5-chlorothiadiazol-4-yl)methylamino]propanamide (PubChem CID 97088815) has the molecular formula C12H12Cl2N4OS and a molecular weight of 331.23 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)-2-[(5-chlorothiadiazol-4-yl)methylamino]propanamide.
| Compound Name | (2S)-2-(3-chlorophenyl)-2-[(5-chlorothiadiazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 97088815 |
| Molecular Formula | C12H12Cl2N4OS |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)-2-[(5-chlorothiadiazol-4-yl)methylamino]propanamide |
| SMILES | C[C@@](NCc1nnsc1Cl)(C(N)=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N4OS/c1-12(11(15)19,7-3-2-4-8(13)5-7)16-6-9-10(14)20-18-17-9/h2-5,16H,6H2,1H3,(H2,15,19)/t12-/m0/s1 |
| InChIKey | WZBMMIJVRNMKTI-LBPRGKRZSA-N |
| XLogP | 2.34 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |