C17H19ClN2O2 — CID 97238718
(2R)-2-(3-chlorophenyl)-2-[(3-methoxyphenyl)methylamino]propanamide (PubChem CID 97238718) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenyl)-2-[(3-methoxyphenyl)methylamino]propanamide.
| Compound Name | (2R)-2-(3-chlorophenyl)-2-[(3-methoxyphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 97238718 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (2R)-2-(3-chlorophenyl)-2-[(3-methoxyphenyl)methylamino]propanamide |
| SMILES | COc1cccc(CN[C@@](C)(C(N)=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-17(16(19)21,13-6-4-7-14(18)10-13)20-11-12-5-3-8-15(9-12)22-2/h3-10,20H,11H2,1-2H3,(H2,19,21)/t17-/m1/s1 |
| InChIKey | ATNOHHMTGCSPDR-QGZVFWFLSA-N |
| XLogP | 2.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |