C22H24NO5+ — CID 7197777
diethyl-[[6-hydroxy-2-[(4-methoxycarbonylphenyl)methylidene]-3-oxo-1-benzofuran-7-yl]methyl]azanium (PubChem CID 7197777) has the molecular formula C22H24NO5+ and a molecular weight of 382.44 g/mol. Its IUPAC name is diethyl-[[6-hydroxy-2-[(4-methoxycarbonylphenyl)methylidene]-3-oxo-1-benzofuran-7-yl]methyl]azanium.
| Compound Name | diethyl-[[6-hydroxy-2-[(4-methoxycarbonylphenyl)methylidene]-3-oxo-1-benzofuran-7-yl]methyl]azanium |
|---|---|
| PubChem CID | 7197777 |
| Molecular Formula | C22H24NO5+ |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | diethyl-[[6-hydroxy-2-[(4-methoxycarbonylphenyl)methylidene]-3-oxo-1-benzofuran-7-yl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1c(O)ccc2c1OC(=Cc1ccc(C(=O)OC)cc1)C2=O |
| InChI | InChI=1S/C22H23NO5/c1-4-23(5-2)13-17-18(24)11-10-16-20(25)19(28-21(16)17)12-14-6-8-15(9-7-14)22(26)27-3/h6-12,24H,4-5,13H2,1-3H3/p+1 |
| InChIKey | ZWGWLEKZFBFZLT-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 77.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|