C12H21F3N2O3S — CID 71977819
1-(oxan-4-ylsulfonyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine (PubChem CID 71977819) has the molecular formula C12H21F3N2O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-(oxan-4-ylsulfonyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine.
| Compound Name | 1-(oxan-4-ylsulfonyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine |
|---|---|
| PubChem CID | 71977819 |
| Molecular Formula | C12H21F3N2O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-(oxan-4-ylsulfonyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine |
| SMILES | CC(N1CCN(S(=O)(=O)C2CCOCC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O3S/c1-10(12(13,14)15)16-4-6-17(7-5-16)21(18,19)11-2-8-20-9-3-11/h10-11H,2-9H2,1H3 |
| InChIKey | CEONSILVDFWNBW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |