C23H26NO4+ — CID 7197834
6-hydroxy-2-[(2-methoxyphenyl)methylidene]-7-[[(2R)-2-methylpiperidin-1-ium-1-yl]methyl]-1-benzofuran-3-one (PubChem CID 7197834) has the molecular formula C23H26NO4+ and a molecular weight of 380.46 g/mol. Its IUPAC name is 6-hydroxy-2-[(2-methoxyphenyl)methylidene]-7-[[(2R)-2-methylpiperidin-1-ium-1-yl]methyl]-1-benzofuran-3-one.
| Compound Name | 6-hydroxy-2-[(2-methoxyphenyl)methylidene]-7-[[(2R)-2-methylpiperidin-1-ium-1-yl]methyl]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 7197834 |
| Molecular Formula | C23H26NO4+ |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 6-hydroxy-2-[(2-methoxyphenyl)methylidene]-7-[[(2R)-2-methylpiperidin-1-ium-1-yl]methyl]-1-benzofuran-3-one |
| SMILES | COc1ccccc1C=C1Oc2c(ccc(O)c2C[NH+]2CCCC[C@H]2C)C1=O |
| InChI | InChI=1S/C23H25NO4/c1-15-7-5-6-12-24(15)14-18-19(25)11-10-17-22(26)21(28-23(17)18)13-16-8-3-4-9-20(16)27-2/h3-4,8-11,13,15,25H,5-7,12,14H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | CAEYRKUXZWZVOL-OAHLLOKOSA-O |
| XLogP | 2.97 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|