C14H15Cl2N3O2 — CID 71978649
5-chloro-4-[2-(2-chlorophenoxy)butylamino]-1H-pyridazin-6-one (PubChem CID 71978649) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 5-chloro-4-[2-(2-chlorophenoxy)butylamino]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[2-(2-chlorophenoxy)butylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 71978649 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 5-chloro-4-[2-(2-chlorophenoxy)butylamino]-1H-pyridazin-6-one |
| SMILES | CCC(CNc1cn[nH]c(=O)c1Cl)Oc1ccccc1Cl |
| InChI | InChI=1S/C14H15Cl2N3O2/c1-2-9(21-12-6-4-3-5-10(12)15)7-17-11-8-18-19-14(20)13(11)16/h3-6,8-9H,2,7H2,1H3,(H2,17,19,20) |
| InChIKey | AJCNFVJUPWLNDU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |