C16H26N4OS — CID 71978932
1-(1-cyclopentylpiperidin-4-yl)-3-(5-ethyl-1,3-thiazol-2-yl)urea (PubChem CID 71978932) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is 1-(1-cyclopentylpiperidin-4-yl)-3-(5-ethyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1-cyclopentylpiperidin-4-yl)-3-(5-ethyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 71978932 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-(1-cyclopentylpiperidin-4-yl)-3-(5-ethyl-1,3-thiazol-2-yl)urea |
| SMILES | CCc1cnc(NC(=O)NC2CCN(C3CCCC3)CC2)s1 |
| InChI | InChI=1S/C16H26N4OS/c1-2-14-11-17-16(22-14)19-15(21)18-12-7-9-20(10-8-12)13-5-3-4-6-13/h11-13H,2-10H2,1H3,(H2,17,18,19,21) |
| InChIKey | QVTDYXNHBPVGPA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |