C12H20N4OS — CID 71998287
1-(5-ethyl-1,3-thiazol-2-yl)-3-(1-methylpiperidin-4-yl)urea (PubChem CID 71998287) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 1-(5-ethyl-1,3-thiazol-2-yl)-3-(1-methylpiperidin-4-yl)urea.
| Compound Name | 1-(5-ethyl-1,3-thiazol-2-yl)-3-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 71998287 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(5-ethyl-1,3-thiazol-2-yl)-3-(1-methylpiperidin-4-yl)urea |
| SMILES | CCc1cnc(NC(=O)NC2CCN(C)CC2)s1 |
| InChI | InChI=1S/C12H20N4OS/c1-3-10-8-13-12(18-10)15-11(17)14-9-4-6-16(2)7-5-9/h8-9H,3-7H2,1-2H3,(H2,13,14,15,17) |
| InChIKey | PMSODKHAKOTQHK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |