C17H20F3N3O — CID 71979281
3-cyano-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]benzamide (PubChem CID 71979281) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-cyano-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]benzamide.
| Compound Name | 3-cyano-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 71979281 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-cyano-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NCCC2CCN(CC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C17H20F3N3O/c18-17(19,20)12-23-8-5-13(6-9-23)4-7-22-16(24)15-3-1-2-14(10-15)11-21/h1-3,10,13H,4-9,12H2,(H,22,24) |
| InChIKey | OWKMHWABMLGCCZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |