C18H32N2O2S — CID 71979355
N-(3-ethylsulfanylcyclohexyl)-1-(2-methylpropanoyl)piperidine-4-carboxamide (PubChem CID 71979355) has the molecular formula C18H32N2O2S and a molecular weight of 340.53 g/mol. Its IUPAC name is N-(3-ethylsulfanylcyclohexyl)-1-(2-methylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-(3-ethylsulfanylcyclohexyl)-1-(2-methylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71979355 |
| Molecular Formula | C18H32N2O2S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-(3-ethylsulfanylcyclohexyl)-1-(2-methylpropanoyl)piperidine-4-carboxamide |
| SMILES | CCSC1CCCC(NC(=O)C2CCN(C(=O)C(C)C)CC2)C1 |
| InChI | InChI=1S/C18H32N2O2S/c1-4-23-16-7-5-6-15(12-16)19-17(21)14-8-10-20(11-9-14)18(22)13(2)3/h13-16H,4-12H2,1-3H3,(H,19,21) |
| InChIKey | GXGDPZXFGKPSTR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |