About 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide
2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide (PubChem CID 71981053) has the molecular formula C14H19NO2S
and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide |
| PubChem CID | 71981053 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide |
| SMILES | CC=CCS(=O)CC(=O)N(CC)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2S/c1-3-5-11-18(17)12-14(16)15(4-2)13-9-7-6-8-10-13/h3,5-10H,4,11-12H2,1-2H3 |
| InChIKey | QJEYMCQNCTYKLP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide?
The IUPAC name of 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide (CID 71981053) is 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide.
What is the SMILES notation for 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide?
The canonical SMILES for 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide is CC=CCS(=O)CC(=O)N(CC)c1ccccc1.
What is the InChIKey of 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide?
The InChIKey is QJEYMCQNCTYKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2S/c1-3-5-11-18(17)12-14(16)15(4-2)13-9-7-6-8-10-13/h3,5-10H,4,11-12H2,1-2H3.
What are the key properties of 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide?
2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide has a molecular weight of 265.38 g/mol, XLogP of 2.36, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-2-enylsulfinyl-N-ethyl-N-phenylacetamide is sourced from PubChem (CID 71981053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).