C16H15FN2O3S — CID 71985209
2-fluoro-4,5-dimethoxy-N-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methyl]aniline (PubChem CID 71985209) has the molecular formula C16H15FN2O3S and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-fluoro-4,5-dimethoxy-N-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methyl]aniline.
| Compound Name | 2-fluoro-4,5-dimethoxy-N-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 71985209 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-fluoro-4,5-dimethoxy-N-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methyl]aniline |
| SMILES | COc1cc(F)c(NCc2ncc(-c3cccs3)o2)cc1OC |
| InChI | InChI=1S/C16H15FN2O3S/c1-20-12-6-10(17)11(7-13(12)21-2)18-9-16-19-8-14(22-16)15-4-3-5-23-15/h3-8,18H,9H2,1-2H3 |
| InChIKey | SXUHHRSYVXGPTA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|