C15H18FN3O2S — CID 71987205
N-[[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]methyl]-6-fluoro-N-methylpyridine-3-carboxamide (PubChem CID 71987205) has the molecular formula C15H18FN3O2S and a molecular weight of 323.39 g/mol. Its IUPAC name is N-[[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]methyl]-6-fluoro-N-methylpyridine-3-carboxamide.
| Compound Name | N-[[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]methyl]-6-fluoro-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71987205 |
| Molecular Formula | C15H18FN3O2S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[[2-(1-ethoxyethyl)-1,3-thiazol-4-yl]methyl]-6-fluoro-N-methylpyridine-3-carboxamide |
| SMILES | CCOC(C)c1nc(CN(C)C(=O)c2ccc(F)nc2)cs1 |
| InChI | InChI=1S/C15H18FN3O2S/c1-4-21-10(2)14-18-12(9-22-14)8-19(3)15(20)11-5-6-13(16)17-7-11/h5-7,9-10H,4,8H2,1-3H3 |
| InChIKey | ZTVODIUNFCXJJE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|