C16H16O5 — CID 71987439
(3,4-dimethoxyphenyl) 2-(furan-2-yl)cyclopropane-1-carboxylate (PubChem CID 71987439) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl) 2-(furan-2-yl)cyclopropane-1-carboxylate.
| Compound Name | (3,4-dimethoxyphenyl) 2-(furan-2-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71987439 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (3,4-dimethoxyphenyl) 2-(furan-2-yl)cyclopropane-1-carboxylate |
| SMILES | COc1ccc(OC(=O)C2CC2c2ccco2)cc1OC |
| InChI | InChI=1S/C16H16O5/c1-18-14-6-5-10(8-15(14)19-2)21-16(17)12-9-11(12)13-4-3-7-20-13/h3-8,11-12H,9H2,1-2H3 |
| InChIKey | CWAYYQZBZKNPLM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|