C15H13NO4 — CID 47449984
(3-carbamoylphenyl) 2-(furan-2-yl)cyclopropane-1-carboxylate (PubChem CID 47449984) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is (3-carbamoylphenyl) 2-(furan-2-yl)cyclopropane-1-carboxylate.
| Compound Name | (3-carbamoylphenyl) 2-(furan-2-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 47449984 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (3-carbamoylphenyl) 2-(furan-2-yl)cyclopropane-1-carboxylate |
| SMILES | NC(=O)c1cccc(OC(=O)C2CC2c2ccco2)c1 |
| InChI | InChI=1S/C15H13NO4/c16-14(17)9-3-1-4-10(7-9)20-15(18)12-8-11(12)13-5-2-6-19-13/h1-7,11-12H,8H2,(H2,16,17) |
| InChIKey | NZCTXEXJTMOBGZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|