C14H17NO4 — CID 94201532
(3-carbamoylphenyl) (2R)-2-(cyclopropylmethoxy)propanoate (PubChem CID 94201532) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (3-carbamoylphenyl) (2R)-2-(cyclopropylmethoxy)propanoate.
| Compound Name | (3-carbamoylphenyl) (2R)-2-(cyclopropylmethoxy)propanoate |
|---|---|
| PubChem CID | 94201532 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (3-carbamoylphenyl) (2R)-2-(cyclopropylmethoxy)propanoate |
| SMILES | C[C@@H](OCC1CC1)C(=O)Oc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C14H17NO4/c1-9(18-8-10-5-6-10)14(17)19-12-4-2-3-11(7-12)13(15)16/h2-4,7,9-10H,5-6,8H2,1H3,(H2,15,16)/t9-/m1/s1 |
| InChIKey | LXDLUGKNSRCYMY-SECBINFHSA-N |
| XLogP | 1.51 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|