About but-3-yn-2-yl quinoline-2-carboxylate
but-3-yn-2-yl quinoline-2-carboxylate (PubChem CID 71987794) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is but-3-yn-2-yl quinoline-2-carboxylate.
Molecular Properties
| Compound Name | but-3-yn-2-yl quinoline-2-carboxylate |
| PubChem CID | 71987794 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | but-3-yn-2-yl quinoline-2-carboxylate |
| SMILES | C#CC(C)OC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H11NO2/c1-3-10(2)17-14(16)13-9-8-11-6-4-5-7-12(11)15-13/h1,4-10H,2H3 |
| InChIKey | XSIBMKPUJYLPHO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-yn-2-yl quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-yn-2-yl quinoline-2-carboxylate?
The IUPAC name of but-3-yn-2-yl quinoline-2-carboxylate (CID 71987794) is but-3-yn-2-yl quinoline-2-carboxylate.
What is the SMILES notation for but-3-yn-2-yl quinoline-2-carboxylate?
The canonical SMILES for but-3-yn-2-yl quinoline-2-carboxylate is C#CC(C)OC(=O)c1ccc2ccccc2n1.
What is the InChIKey of but-3-yn-2-yl quinoline-2-carboxylate?
The InChIKey is XSIBMKPUJYLPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c1-3-10(2)17-14(16)13-9-8-11-6-4-5-7-12(11)15-13/h1,4-10H,2H3.
What are the key properties of but-3-yn-2-yl quinoline-2-carboxylate?
but-3-yn-2-yl quinoline-2-carboxylate has a molecular weight of 225.25 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-yn-2-yl quinoline-2-carboxylate is sourced from PubChem (CID 71987794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).