C16H20N4O2 — CID 71988198
(3-methylcyclohexyl) 1-(pyridin-2-ylmethyl)triazole-4-carboxylate (PubChem CID 71988198) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3-methylcyclohexyl) 1-(pyridin-2-ylmethyl)triazole-4-carboxylate.
| Compound Name | (3-methylcyclohexyl) 1-(pyridin-2-ylmethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 71988198 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3-methylcyclohexyl) 1-(pyridin-2-ylmethyl)triazole-4-carboxylate |
| SMILES | CC1CCCC(OC(=O)c2cn(Cc3ccccn3)nn2)C1 |
| InChI | InChI=1S/C16H20N4O2/c1-12-5-4-7-14(9-12)22-16(21)15-11-20(19-18-15)10-13-6-2-3-8-17-13/h2-3,6,8,11-12,14H,4-5,7,9-10H2,1H3 |
| InChIKey | VACAMOXVWIHIJS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |