About 2-propylcyclohexan-1-one
2-propylcyclohexan-1-one (PubChem CID 7199) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-propylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2-propylcyclohexan-1-one |
| PubChem CID | 7199 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2-propylcyclohexan-1-one |
| SMILES | CCCC1CCCCC1=O |
| InChI | InChI=1S/C9H16O/c1-2-5-8-6-3-4-7-9(8)10/h8H,2-7H2,1H3 |
| InChIKey | OCJLPZCBZSCVCO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylcyclohexan-1-one?
The IUPAC name of 2-propylcyclohexan-1-one (CID 7199) is 2-propylcyclohexan-1-one.
What is the SMILES notation for 2-propylcyclohexan-1-one?
The canonical SMILES for 2-propylcyclohexan-1-one is CCCC1CCCCC1=O.
What is the InChIKey of 2-propylcyclohexan-1-one?
The InChIKey is OCJLPZCBZSCVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-2-5-8-6-3-4-7-9(8)10/h8H,2-7H2,1H3.
What are the key properties of 2-propylcyclohexan-1-one?
2-propylcyclohexan-1-one has a molecular weight of 140.23 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylcyclohexan-1-one is sourced from PubChem (CID 7199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).