C18H20N4O3 — CID 71990409
1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 71990409) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 71990409 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[(2-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | CC(O)(CNC(=O)NCc1ccccc1-n1cccn1)c1ccco1 |
| InChI | InChI=1S/C18H20N4O3/c1-18(24,16-8-4-11-25-16)13-20-17(23)19-12-14-6-2-3-7-15(14)22-10-5-9-21-22/h2-11,24H,12-13H2,1H3,(H2,19,20,23) |
| InChIKey | LLCXMMGZVNTEOJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |