C20H27N4OS+ — CID 7199100
5-[(R)-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(3-methylphenyl)methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 7199100) has the molecular formula C20H27N4OS+ and a molecular weight of 371.53 g/mol. Its IUPAC name is 5-[(R)-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(3-methylphenyl)methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(R)-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(3-methylphenyl)methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 7199100 |
| Molecular Formula | C20H27N4OS+ |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 5-[(R)-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(3-methylphenyl)methyl]-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | Cc1cccc([C@H](c2sc3nc(C)nn3c2O)[NH+]2C[C@@H](C)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C20H26N4OS/c1-12-6-5-7-16(9-12)17(23-10-13(2)8-14(3)11-23)18-19(25)24-20(26-18)21-15(4)22-24/h5-7,9,13-14,17,25H,8,10-11H2,1-4H3/p+1/t13-,14-,17+/m0/s1 |
| InChIKey | YKSSBHDJIUVGOV-GRDNDAEWSA-O |
| XLogP | 2.76 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |