C21H29N4OS+ — CID 7293965
5-[(R)-[(3R,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(4-methylphenyl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 7293965) has the molecular formula C21H29N4OS+ and a molecular weight of 385.56 g/mol. Its IUPAC name is 5-[(R)-[(3R,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(4-methylphenyl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(R)-[(3R,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(4-methylphenyl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 7293965 |
| Molecular Formula | C21H29N4OS+ |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 5-[(R)-[(3R,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(4-methylphenyl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | CCc1nc2sc([C@@H](c3ccc(C)cc3)[NH+]3C[C@H](C)C[C@H](C)C3)c(O)n2n1 |
| InChI | InChI=1S/C21H28N4OS/c1-5-17-22-21-25(23-17)20(26)19(27-21)18(16-8-6-13(2)7-9-16)24-11-14(3)10-15(4)12-24/h6-9,14-15,18,26H,5,10-12H2,1-4H3/p+1/t14-,15+,18-/m1/s1 |
| InChIKey | AHCGVMQAMMKOBS-RVKKMQEKSA-O |
| XLogP | 3.02 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |