C22H31N4O2S+ — CID 7293989
5-[(R)-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(4-ethoxyphenyl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 7293989) has the molecular formula C22H31N4O2S+ and a molecular weight of 415.58 g/mol. Its IUPAC name is 5-[(R)-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(4-ethoxyphenyl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[(R)-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(4-ethoxyphenyl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 7293989 |
| Molecular Formula | C22H31N4O2S+ |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 5-[(R)-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]-(4-ethoxyphenyl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | CCOc1ccc([C@H](c2sc3nc(CC)nn3c2O)[NH+]2C[C@@H](C)C[C@H](C)C2)cc1 |
| InChI | InChI=1S/C22H30N4O2S/c1-5-18-23-22-26(24-18)21(27)20(29-22)19(25-12-14(3)11-15(4)13-25)16-7-9-17(10-8-16)28-6-2/h7-10,14-15,19,27H,5-6,11-13H2,1-4H3/p+1/t14-,15-,19+/m0/s1 |
| InChIKey | CAGJIBIIVMKPNX-YZVOILCLSA-O |
| XLogP | 3.11 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |