C13H23NOS — CID 71993245
2-cyclopent-2-en-1-yl-N-(4-ethylsulfanylbutan-2-yl)acetamide (PubChem CID 71993245) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(4-ethylsulfanylbutan-2-yl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(4-ethylsulfanylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 71993245 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(4-ethylsulfanylbutan-2-yl)acetamide |
| SMILES | CCSCCC(C)NC(=O)CC1C=CCC1 |
| InChI | InChI=1S/C13H23NOS/c1-3-16-9-8-11(2)14-13(15)10-12-6-4-5-7-12/h4,6,11-12H,3,5,7-10H2,1-2H3,(H,14,15) |
| InChIKey | FLDPAJHHNSCHFE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|