C17H18FNO3S — CID 71994782
N-[2-(benzenesulfinyl)ethyl]-2-ethoxy-3-fluorobenzamide (PubChem CID 71994782) has the molecular formula C17H18FNO3S and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[2-(benzenesulfinyl)ethyl]-2-ethoxy-3-fluorobenzamide.
| Compound Name | N-[2-(benzenesulfinyl)ethyl]-2-ethoxy-3-fluorobenzamide |
|---|---|
| PubChem CID | 71994782 |
| Molecular Formula | C17H18FNO3S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[2-(benzenesulfinyl)ethyl]-2-ethoxy-3-fluorobenzamide |
| SMILES | CCOc1c(F)cccc1C(=O)NCCS(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18FNO3S/c1-2-22-16-14(9-6-10-15(16)18)17(20)19-11-12-23(21)13-7-4-3-5-8-13/h3-10H,2,11-12H2,1H3,(H,19,20) |
| InChIKey | DKNBHZXSCILBGQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |