C15H24N2O3 — CID 71995751
ethyl 1-oxospiro[2,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine-3,4'-cyclohexane]-1'-carboxylate (PubChem CID 71995751) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is ethyl 1-oxospiro[2,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine-3,4'-cyclohexane]-1'-carboxylate.
| Compound Name | ethyl 1-oxospiro[2,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine-3,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 71995751 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | ethyl 1-oxospiro[2,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridine-3,4'-cyclohexane]-1'-carboxylate |
| SMILES | CCOC(=O)C1CCC2(CC1)NC(=O)C1CCCCN12 |
| InChI | InChI=1S/C15H24N2O3/c1-2-20-14(19)11-6-8-15(9-7-11)16-13(18)12-5-3-4-10-17(12)15/h11-12H,2-10H2,1H3,(H,16,18) |
| InChIKey | DNCHZGLTNNLQPX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |