C14H11Cl2N3O2 — CID 71997097
6,8-dichloro-3-[(5-ethyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one (PubChem CID 71997097) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 6,8-dichloro-3-[(5-ethyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one.
| Compound Name | 6,8-dichloro-3-[(5-ethyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 71997097 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 6,8-dichloro-3-[(5-ethyl-1,3-oxazol-2-yl)methyl]quinazolin-4-one |
| SMILES | CCc1cnc(Cn2cnc3c(Cl)cc(Cl)cc3c2=O)o1 |
| InChI | InChI=1S/C14H11Cl2N3O2/c1-2-9-5-17-12(21-9)6-19-7-18-13-10(14(19)20)3-8(15)4-11(13)16/h3-5,7H,2,6H2,1H3 |
| InChIKey | FHLQUSPXXPYYTH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |