C14H16F3N3O2S — CID 71997603
1-propan-2-yl-N-[1-(3,4,5-trifluorophenyl)ethyl]pyrazole-4-sulfonamide (PubChem CID 71997603) has the molecular formula C14H16F3N3O2S and a molecular weight of 347.36 g/mol. Its IUPAC name is 1-propan-2-yl-N-[1-(3,4,5-trifluorophenyl)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-propan-2-yl-N-[1-(3,4,5-trifluorophenyl)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 71997603 |
| Molecular Formula | C14H16F3N3O2S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-propan-2-yl-N-[1-(3,4,5-trifluorophenyl)ethyl]pyrazole-4-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cnn(C(C)C)c1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H16F3N3O2S/c1-8(2)20-7-11(6-18-20)23(21,22)19-9(3)10-4-12(15)14(17)13(16)5-10/h4-9,19H,1-3H3 |
| InChIKey | WFPMYKIRLBIDBJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|