C18H19FN4O4S2 — CID 166215188
1-(2-fluorophenyl)-N-[1-[3-(methylsulfamoyl)phenyl]ethyl]pyrazole-4-sulfonamide (PubChem CID 166215188) has the molecular formula C18H19FN4O4S2 and a molecular weight of 438.51 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[1-[3-(methylsulfamoyl)phenyl]ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-(2-fluorophenyl)-N-[1-[3-(methylsulfamoyl)phenyl]ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 166215188 |
| Molecular Formula | C18H19FN4O4S2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[1-[3-(methylsulfamoyl)phenyl]ethyl]pyrazole-4-sulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(C(C)NS(=O)(=O)c2cnn(-c3ccccc3F)c2)c1 |
| InChI | InChI=1S/C18H19FN4O4S2/c1-13(14-6-5-7-15(10-14)28(24,25)20-2)22-29(26,27)16-11-21-23(12-16)18-9-4-3-8-17(18)19/h3-13,20,22H,1-2H3 |
| InChIKey | VQVZMYQXZRBWKE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |