C17H23FN4O2S — CID 119983754
N-(2-amino-1-cyclohexylethyl)-1-(2-fluorophenyl)pyrazole-4-sulfonamide (PubChem CID 119983754) has the molecular formula C17H23FN4O2S and a molecular weight of 366.46 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-1-(2-fluorophenyl)pyrazole-4-sulfonamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-1-(2-fluorophenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 119983754 |
| Molecular Formula | C17H23FN4O2S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-1-(2-fluorophenyl)pyrazole-4-sulfonamide |
| SMILES | NCC(NS(=O)(=O)c1cnn(-c2ccccc2F)c1)C1CCCCC1 |
| InChI | InChI=1S/C17H23FN4O2S/c18-15-8-4-5-9-17(15)22-12-14(11-20-22)25(23,24)21-16(10-19)13-6-2-1-3-7-13/h4-5,8-9,11-13,16,21H,1-3,6-7,10,19H2 |
| InChIKey | PXIBYNCJNCMXEV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |