C12H18FN3O2S — CID 106737928
N-(2-amino-1-cyclopentylethyl)-3-fluoropyridine-2-sulfonamide (PubChem CID 106737928) has the molecular formula C12H18FN3O2S and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106737928 |
| Molecular Formula | C12H18FN3O2S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-3-fluoropyridine-2-sulfonamide |
| SMILES | NCC(NS(=O)(=O)c1ncccc1F)C1CCCC1 |
| InChI | InChI=1S/C12H18FN3O2S/c13-10-6-3-7-15-12(10)19(17,18)16-11(8-14)9-4-1-2-5-9/h3,6-7,9,11,16H,1-2,4-5,8,14H2 |
| InChIKey | GHYKFANQAQCHGE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |