C17H23N3O2S — CID 120585095
N-(2-amino-1-cyclopentylethyl)-8-methylquinoline-5-sulfonamide (PubChem CID 120585095) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-8-methylquinoline-5-sulfonamide.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-8-methylquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 120585095 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-8-methylquinoline-5-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CN)C2CCCC2)c2cccnc12 |
| InChI | InChI=1S/C17H23N3O2S/c1-12-8-9-16(14-7-4-10-19-17(12)14)23(21,22)20-15(11-18)13-5-2-3-6-13/h4,7-10,13,15,20H,2-3,5-6,11,18H2,1H3 |
| InChIKey | BMYLHMORRZTKBM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |