C15H26N4O3S — CID 120584893
N-(2-amino-1-cyclopentylethyl)-1-(oxan-4-yl)pyrazole-4-sulfonamide (PubChem CID 120584893) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-1-(oxan-4-yl)pyrazole-4-sulfonamide.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-1-(oxan-4-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 120584893 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-1-(oxan-4-yl)pyrazole-4-sulfonamide |
| SMILES | NCC(NS(=O)(=O)c1cnn(C2CCOCC2)c1)C1CCCC1 |
| InChI | InChI=1S/C15H26N4O3S/c16-9-15(12-3-1-2-4-12)18-23(20,21)14-10-17-19(11-14)13-5-7-22-8-6-13/h10-13,15,18H,1-9,16H2 |
| InChIKey | OQVZFFJFJPWOGX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |