C14H21F2N3O3S — CID 138041823
N-(4,4-difluorocyclohexyl)-1-(oxan-4-yl)pyrazole-4-sulfonamide (PubChem CID 138041823) has the molecular formula C14H21F2N3O3S and a molecular weight of 349.40 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-1-(oxan-4-yl)pyrazole-4-sulfonamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-1-(oxan-4-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 138041823 |
| Molecular Formula | C14H21F2N3O3S |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-1-(oxan-4-yl)pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NC1CCC(F)(F)CC1)c1cnn(C2CCOCC2)c1 |
| InChI | InChI=1S/C14H21F2N3O3S/c15-14(16)5-1-11(2-6-14)18-23(20,21)13-9-17-19(10-13)12-3-7-22-8-4-12/h9-12,18H,1-8H2 |
| InChIKey | OCTVDEWRMHEDTO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |