C16H21N7O2 — CID 71997939
N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-4-methoxy-3-(5-methyltetrazol-1-yl)aniline (PubChem CID 71997939) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-4-methoxy-3-(5-methyltetrazol-1-yl)aniline.
| Compound Name | N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-4-methoxy-3-(5-methyltetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 71997939 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-4-methoxy-3-(5-methyltetrazol-1-yl)aniline |
| SMILES | COc1ccc(NCc2noc(C(C)(C)C)n2)cc1-n1nnnc1C |
| InChI | InChI=1S/C16H21N7O2/c1-10-19-21-22-23(10)12-8-11(6-7-13(12)24-5)17-9-14-18-15(25-20-14)16(2,3)4/h6-8,17H,9H2,1-5H3 |
| InChIKey | VVOJBPPUAGYEIJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|