C15H23F3N2O2 — CID 71998426
N-ethyl-1-(3-methylbut-2-enoyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 71998426) has the molecular formula C15H23F3N2O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is N-ethyl-1-(3-methylbut-2-enoyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | N-ethyl-1-(3-methylbut-2-enoyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 71998426 |
| Molecular Formula | C15H23F3N2O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-ethyl-1-(3-methylbut-2-enoyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | CCN(CC(F)(F)F)C(=O)C1CCCN(C(=O)C=C(C)C)C1 |
| InChI | InChI=1S/C15H23F3N2O2/c1-4-19(10-15(16,17)18)14(22)12-6-5-7-20(9-12)13(21)8-11(2)3/h8,12H,4-7,9-10H2,1-3H3 |
| InChIKey | HPMYGRYITVVUJJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|