C19H25NO3 — CID 71999082
[5-methyl-2-(2-methylphenyl)morpholin-4-yl]-(7-oxabicyclo[2.2.1]heptan-2-yl)methanone (PubChem CID 71999082) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is [5-methyl-2-(2-methylphenyl)morpholin-4-yl]-(7-oxabicyclo[2.2.1]heptan-2-yl)methanone.
| Compound Name | [5-methyl-2-(2-methylphenyl)morpholin-4-yl]-(7-oxabicyclo[2.2.1]heptan-2-yl)methanone |
|---|---|
| PubChem CID | 71999082 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [5-methyl-2-(2-methylphenyl)morpholin-4-yl]-(7-oxabicyclo[2.2.1]heptan-2-yl)methanone |
| SMILES | Cc1ccccc1C1CN(C(=O)C2CC3CCC2O3)C(C)CO1 |
| InChI | InChI=1S/C19H25NO3/c1-12-5-3-4-6-15(12)18-10-20(13(2)11-22-18)19(21)16-9-14-7-8-17(16)23-14/h3-6,13-14,16-18H,7-11H2,1-2H3 |
| InChIKey | OPDLMRNIDWKRHD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |