C11H21NO3 — CID 7201245
(3aS,4S,6aS)-5-tert-butyl-3a-methyl-2,3,4,6-tetrahydrofuro[2,3-c]pyrrole-4,6a-diol (PubChem CID 7201245) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (3aS,4S,6aS)-5-tert-butyl-3a-methyl-2,3,4,6-tetrahydrofuro[2,3-c]pyrrole-4,6a-diol.
| Compound Name | (3aS,4S,6aS)-5-tert-butyl-3a-methyl-2,3,4,6-tetrahydrofuro[2,3-c]pyrrole-4,6a-diol |
|---|---|
| PubChem CID | 7201245 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (3aS,4S,6aS)-5-tert-butyl-3a-methyl-2,3,4,6-tetrahydrofuro[2,3-c]pyrrole-4,6a-diol |
| SMILES | CC(C)(C)N1C[C@@]2(O)OCC[C@@]2(C)[C@@H]1O |
| InChI | InChI=1S/C11H21NO3/c1-9(2,3)12-7-11(14)10(4,8(12)13)5-6-15-11/h8,13-14H,5-7H2,1-4H3/t8-,10-,11+/m0/s1 |
| InChIKey | IOESXKIHYWSPRS-INTQDDNPSA-N |
| XLogP | 0.53 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |