About (5R)-4-tert-butyl-2,2,5-trimethylmorpholine
(5R)-4-tert-butyl-2,2,5-trimethylmorpholine (PubChem CID 168820806) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is (5R)-4-tert-butyl-2,2,5-trimethylmorpholine.
Molecular Properties
| Compound Name | (5R)-4-tert-butyl-2,2,5-trimethylmorpholine |
| PubChem CID | 168820806 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (5R)-4-tert-butyl-2,2,5-trimethylmorpholine |
| SMILES | C[C@@H]1COC(C)(C)CN1C(C)(C)C |
| InChI | InChI=1S/C11H23NO/c1-9-7-13-11(5,6)8-12(9)10(2,3)4/h9H,7-8H2,1-6H3/t9-/m1/s1 |
| InChIKey | TZYDPXUQSCWJQA-SECBINFHSA-N |
| XLogP | 2.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-4-tert-butyl-2,2,5-trimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-4-tert-butyl-2,2,5-trimethylmorpholine?
The IUPAC name of (5R)-4-tert-butyl-2,2,5-trimethylmorpholine (CID 168820806) is (5R)-4-tert-butyl-2,2,5-trimethylmorpholine.
What is the SMILES notation for (5R)-4-tert-butyl-2,2,5-trimethylmorpholine?
The canonical SMILES for (5R)-4-tert-butyl-2,2,5-trimethylmorpholine is C[C@@H]1COC(C)(C)CN1C(C)(C)C.
What is the InChIKey of (5R)-4-tert-butyl-2,2,5-trimethylmorpholine?
The InChIKey is TZYDPXUQSCWJQA-SECBINFHSA-N. The full InChI is InChI=1S/C11H23NO/c1-9-7-13-11(5,6)8-12(9)10(2,3)4/h9H,7-8H2,1-6H3/t9-/m1/s1.
What are the key properties of (5R)-4-tert-butyl-2,2,5-trimethylmorpholine?
(5R)-4-tert-butyl-2,2,5-trimethylmorpholine has a molecular weight of 185.31 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-4-tert-butyl-2,2,5-trimethylmorpholine is sourced from PubChem (CID 168820806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).