C11H23NO — CID 168820806
(5R)-4-tert-butyl-2,2,5-trimethylmorpholine (PubChem CID 168820806) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (5R)-4-tert-butyl-2,2,5-trimethylmorpholine.
| Compound Name | (5R)-4-tert-butyl-2,2,5-trimethylmorpholine |
|---|---|
| PubChem CID | 168820806 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (5R)-4-tert-butyl-2,2,5-trimethylmorpholine |
| SMILES | C[C@@H]1COC(C)(C)CN1C(C)(C)C |
| InChI | InChI=1S/C11H23NO/c1-9-7-13-11(5,6)8-12(9)10(2,3)4/h9H,7-8H2,1-6H3/t9-/m1/s1 |
| InChIKey | TZYDPXUQSCWJQA-SECBINFHSA-N |
| XLogP | 2.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |