C10H20O — CID 59883974
(4S)-4-tert-butyl-2,2-dimethyloxolane (PubChem CID 59883974) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2,2-dimethyloxolane.
| Compound Name | (4S)-4-tert-butyl-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 59883974 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (4S)-4-tert-butyl-2,2-dimethyloxolane |
| SMILES | CC1(C)C[C@@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C10H20O/c1-9(2,3)8-6-10(4,5)11-7-8/h8H,6-7H2,1-5H3/t8-/m1/s1 |
| InChIKey | OSTQRJFECHOAHT-MRVPVSSYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |